C27H46N6O5 — CID 18296033
2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18296033) has the molecular formula C27H46N6O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18296033 |
| Molecular Formula | C27H46N6O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H46N6O5/c1-3-18(2)23(30)26(36)32-21(14-8-10-16-29)24(34)31-20(13-7-9-15-28)25(35)33-22(27(37)38)17-19-11-5-4-6-12-19/h4-6,11-12,18,20-23H,3,7-10,13-17,28-30H2,1-2H3,(H,31,34)(H,32,36)(H,33,35)(H,37,38) |
| InChIKey | KAJYGNJUQFYFOF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|