C10H18N3O6S+ — CID 23278192
[4-carboxy-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxobutan-2-yl]azanium (PubChem CID 23278192) has the molecular formula C10H18N3O6S+ and a molecular weight of 308.34 g/mol. Its IUPAC name is [4-carboxy-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxobutan-2-yl]azanium.
| Compound Name | [4-carboxy-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 23278192 |
| Molecular Formula | C10H18N3O6S+ |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [4-carboxy-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxobutan-2-yl]azanium |
| SMILES | [NH3+]C(CCC(=O)O)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H17N3O6S/c11-5(1-2-7(14)15)9(18)13-6(4-20)10(19)12-3-8(16)17/h5-6,20H,1-4,11H2,(H,12,19)(H,13,18)(H,14,15)(H,16,17)/p+1 |
| InChIKey | ZZIFPJZQHRJERU-UHFFFAOYSA-O |
| XLogP | -2.92 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|