C13H23N5O6S — CID 18235054
2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 18235054) has the molecular formula C13H23N5O6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18235054 |
| Molecular Formula | C13H23N5O6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H23N5O6S/c1-6(14)11(22)17-7(2-3-9(15)19)13(24)18-8(5-25)12(23)16-4-10(20)21/h6-8,25H,2-5,14H2,1H3,(H2,15,19)(H,16,23)(H,17,22)(H,18,24)(H,20,21) |
| InChIKey | GUPISZIZJQPPPA-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|