C5H9N3O4S — CID 87279999
2-[[2-(2-oxohydrazinyl)-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 87279999) has the molecular formula C5H9N3O4S and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-[[2-(2-oxohydrazinyl)-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-oxohydrazinyl)-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 87279999 |
| Molecular Formula | C5H9N3O4S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2-[[2-(2-oxohydrazinyl)-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | O=NNC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9N3O4S/c9-4(10)1-6-5(11)3(2-13)7-8-12/h3,13H,1-2H2,(H,6,11)(H,7,12)(H,9,10) |
| InChIKey | FCHWLJZWPLJMHH-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|