C3H7N3O4S2 — CID 87687859
(2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid;thionitrous S-acid (PubChem CID 87687859) has the molecular formula C3H7N3O4S2 and a molecular weight of 213.24 g/mol. Its IUPAC name is (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid;thionitrous S-acid.
| Compound Name | (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid;thionitrous S-acid |
|---|---|
| PubChem CID | 87687859 |
| Molecular Formula | C3H7N3O4S2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid;thionitrous S-acid |
| SMILES | O=NN[C@H](CS)C(=O)O.O=NS |
| InChI | InChI=1S/C3H6N2O3S.HNOS/c6-3(7)2(1-9)4-5-8;2-1-3/h2,9H,1H2,(H,4,8)(H,6,7);(H,2,3)/t2-;/m1./s1 |
| InChIKey | HVRKMDOEABJCFZ-HSHFZTNMSA-N |
| XLogP | 0.24 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|