C7H11NO6S — CID 87237898
2-[[(1-carboxy-2-sulfanylethyl)amino]methyl]propanedioic acid (PubChem CID 87237898) has the molecular formula C7H11NO6S and a molecular weight of 237.23 g/mol. Its IUPAC name is 2-[[(1-carboxy-2-sulfanylethyl)amino]methyl]propanedioic acid.
| Compound Name | 2-[[(1-carboxy-2-sulfanylethyl)amino]methyl]propanedioic acid |
|---|---|
| PubChem CID | 87237898 |
| Molecular Formula | C7H11NO6S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-[[(1-carboxy-2-sulfanylethyl)amino]methyl]propanedioic acid |
| SMILES | O=C(O)C(CS)NCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO6S/c9-5(10)3(6(11)12)1-8-4(2-15)7(13)14/h3-4,8,15H,1-2H2,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | BGDOPDRFOCVMLS-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|