C6H12N2O5S2 — CID 166514845
(2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]oxyamino]-3-sulfanylpropanoic acid (PubChem CID 166514845) has the molecular formula C6H12N2O5S2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]oxyamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]oxyamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 166514845 |
| Molecular Formula | C6H12N2O5S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]oxyamino]-3-sulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](CS)NON[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H12N2O5S2/c9-5(10)3(1-14)7-13-8-4(2-15)6(11)12/h3-4,7-8,14-15H,1-2H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | DKGUKSOOYFRJRH-IMJSIDKUSA-N |
| XLogP | -1.22 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|