C3H6N2O3S — CID 21157216
(2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid (PubChem CID 21157216) has the molecular formula C3H6N2O3S and a molecular weight of 150.16 g/mol. Its IUPAC name is (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21157216 |
| Molecular Formula | C3H6N2O3S |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | (2S)-2-(2-oxohydrazinyl)-3-sulfanylpropanoic acid |
| SMILES | O=NN[C@H](CS)C(=O)O |
| InChI | InChI=1S/C3H6N2O3S/c6-3(7)2(1-9)4-5-8/h2,9H,1H2,(H,4,8)(H,6,7)/t2-/m1/s1 |
| InChIKey | UXFVXZHEXLYTTN-UWTATZPHSA-N |
| XLogP | -0.36 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|