C5H9NO4S — CID 87097577
(2R)-2-[(2-hydroxyacetyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87097577) has the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. Its IUPAC name is (2R)-2-[(2-hydroxyacetyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-hydroxyacetyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87097577 |
| Molecular Formula | C5H9NO4S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (2R)-2-[(2-hydroxyacetyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(CO)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C5H9NO4S/c7-1-4(8)6-3(2-11)5(9)10/h3,7,11H,1-2H2,(H,6,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | VHWXTCSXNNYCNS-VKHMYHEASA-N |
| XLogP | -1.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|