C9H14N2O5S — CID 10563410
2-[[2-(3-oxobutanoylamino)acetyl]amino]-3-sulfanylpropanoic acid (PubChem CID 10563410) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-[[2-(3-oxobutanoylamino)acetyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-(3-oxobutanoylamino)acetyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 10563410 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[[2-(3-oxobutanoylamino)acetyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)CC(=O)NCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C9H14N2O5S/c1-5(12)2-7(13)10-3-8(14)11-6(4-17)9(15)16/h6,17H,2-4H2,1H3,(H,10,13)(H,11,14)(H,15,16) |
| InChIKey | ANEJKHXWMZEPBK-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|