C11H17N3O6 — CID 40551281
(2S)-5-amino-5-oxo-2-[[2-(3-oxobutanoylamino)acetyl]amino]pentanoic acid (PubChem CID 40551281) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[[2-(3-oxobutanoylamino)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[[2-(3-oxobutanoylamino)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 40551281 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[[2-(3-oxobutanoylamino)acetyl]amino]pentanoic acid |
| SMILES | CC(=O)CC(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H17N3O6/c1-6(15)4-9(17)13-5-10(18)14-7(11(19)20)2-3-8(12)16/h7H,2-5H2,1H3,(H2,12,16)(H,13,17)(H,14,18)(H,19,20)/t7-/m0/s1 |
| InChIKey | AUJZNTOLELIKCH-ZETCQYMHSA-N |
| XLogP | -2.08 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|