C16H24N4O7S2 — CID 58386233
CID 58386233 (PubChem CID 58386233) has the molecular formula C16H24N4O7S2 and a molecular weight of 448.52 g/mol.
| Compound Name | CID 58386233 |
|---|---|
| PubChem CID | 58386233 |
| Molecular Formula | C16H24N4O7S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | — |
| SMILES | [CH][C@H](NC(=O)[C@H](CS)CC(C)=O)C(=O)NCC(=O)NCC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C16H24N4O7S2/c1-8(21)3-10(6-28)15(25)19-9(2)14(24)18-4-12(22)17-5-13(23)20-11(7-29)16(26)27/h2,9-11,28-29H,3-7H2,1H3,(H,17,22)(H,18,24)(H,19,25)(H,20,23)(H,26,27)/t9-,10-,11-/m0/s1 |
| InChIKey | NTKFCMYTFDUOOY-DCAQKATOSA-N |
| XLogP | -2.56 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|