C11H18N4O7 — CID 18235506
2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18235506) has the molecular formula C11H18N4O7 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18235506 |
| Molecular Formula | C11H18N4O7 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]acetyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NCC(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N4O7/c1-5(12)10(20)14-3-7(16)13-4-8(17)15-6(11(21)22)2-9(18)19/h5-6H,2-4,12H2,1H3,(H,13,16)(H,14,20)(H,15,17)(H,18,19)(H,21,22) |
| InChIKey | SQPLQQGKTAXDHP-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |