C9H15NO5S2 — CID 54045483
(2R)-2-[[4-methoxy-4-oxo-2-(sulfanylmethyl)butanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 54045483) has the molecular formula C9H15NO5S2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2R)-2-[[4-methoxy-4-oxo-2-(sulfanylmethyl)butanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[4-methoxy-4-oxo-2-(sulfanylmethyl)butanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54045483 |
| Molecular Formula | C9H15NO5S2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (2R)-2-[[4-methoxy-4-oxo-2-(sulfanylmethyl)butanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | COC(=O)CC(CS)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C9H15NO5S2/c1-15-7(11)2-5(3-16)8(12)10-6(4-17)9(13)14/h5-6,16-17H,2-4H2,1H3,(H,10,12)(H,13,14)/t5?,6-/m0/s1 |
| InChIKey | LPGNUWNDCGVADQ-GDVGLLTNSA-N |
| XLogP | -0.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|