C10H18N4O5S — CID 18218972
2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid (PubChem CID 18218972) has the molecular formula C10H18N4O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18218972 |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
| SMILES | CC(NC(=O)C(N)CC(N)=O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C10H18N4O5S/c1-4(8(16)14-6(3-20)10(18)19)13-9(17)5(11)2-7(12)15/h4-6,20H,2-3,11H2,1H3,(H2,12,15)(H,13,17)(H,14,16)(H,18,19) |
| InChIKey | BRCVLJZIIFBSPF-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|