C15H25N5O8S — CID 22652165
2-[[2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 22652165) has the molecular formula C15H25N5O8S and a molecular weight of 435.46 g/mol. Its IUPAC name is 2-[[2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22652165 |
| Molecular Formula | C15H25N5O8S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[[2-[2-[(2,4-diamino-4-oxobutanoyl)amino]propanoylamino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | CC(NC(=O)C(N)CC(N)=O)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25N5O8S/c1-6(18-13(25)7(16)4-10(17)21)12(24)20-9(5-29)14(26)19-8(15(27)28)2-3-11(22)23/h6-9,29H,2-5,16H2,1H3,(H2,17,21)(H,18,25)(H,19,26)(H,20,24)(H,22,23)(H,27,28) |
| InChIKey | SWBAOBRIUWIFHD-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 231.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|