C8H14FNO3S — CID 172607861
(2R)-2-[(3-fluoro-3-methylbutanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 172607861) has the molecular formula C8H14FNO3S and a molecular weight of 223.27 g/mol. Its IUPAC name is (2R)-2-[(3-fluoro-3-methylbutanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(3-fluoro-3-methylbutanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 172607861 |
| Molecular Formula | C8H14FNO3S |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (2R)-2-[(3-fluoro-3-methylbutanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(F)CC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C8H14FNO3S/c1-8(2,9)3-6(11)10-5(4-14)7(12)13/h5,14H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | QQVFQXMDILJBIO-YFKPBYRVSA-N |
| XLogP | 0.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|