C7H13NO3S2 — CID 2459
2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 2459) has the molecular formula C7H13NO3S2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 2459 |
| Molecular Formula | C7H13NO3S2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(S)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C7H13NO3S2/c1-7(2,13)6(11)8-4(3-12)5(9)10/h4,12-13H,3H2,1-2H3,(H,8,11)(H,9,10) |
| InChIKey | VUAFHZCUKUDDBC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|