C9H18N2O3S — CID 21121295
2-[(2,2-dimethylpropanoylamino)methylamino]-3-sulfanylpropanoic acid (PubChem CID 21121295) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(2,2-dimethylpropanoylamino)methylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2,2-dimethylpropanoylamino)methylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21121295 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[(2,2-dimethylpropanoylamino)methylamino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(C)C(=O)NCNC(CS)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S/c1-9(2,3)8(14)11-5-10-6(4-15)7(12)13/h6,10,15H,4-5H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | UBENVAHPSYMDLE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|