C8H15NO3S2 — CID 14969956
(2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-4-sulfanylbutanoic acid (PubChem CID 14969956) has the molecular formula C8H15NO3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is (2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-4-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 14969956 |
| Molecular Formula | C8H15NO3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | (2R)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-4-sulfanylbutanoic acid |
| SMILES | CC(C)(S)C(=O)N[C@H](CCS)C(=O)O |
| InChI | InChI=1S/C8H15NO3S2/c1-8(2,14)7(12)9-5(3-4-13)6(10)11/h5,13-14H,3-4H2,1-2H3,(H,9,12)(H,10,11)/t5-/m1/s1 |
| InChIKey | QFPIAXFOSYMMDD-RXMQYKEDSA-N |
| XLogP | 0.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|