C9H17NO3S2 — CID 170448274
3-ethylsulfanyl-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid (PubChem CID 170448274) has the molecular formula C9H17NO3S2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-ethylsulfanyl-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid.
| Compound Name | 3-ethylsulfanyl-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 170448274 |
| Molecular Formula | C9H17NO3S2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-ethylsulfanyl-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid |
| SMILES | CCSCC(NC(=O)C(C)(C)S)C(=O)O |
| InChI | InChI=1S/C9H17NO3S2/c1-4-15-5-6(7(11)12)10-8(13)9(2,3)14/h6,14H,4-5H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | QTMLTKHSJLMWCF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|