C23H42N2O6S7 — CID 167189726
3-[[3-[[2-carboxy-2-[(2-methyl-2-sulfanylpropanoyl)amino]ethyl]disulfanyl]-8-sulfanylnonyl]disulfanyl]-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid (PubChem CID 167189726) has the molecular formula C23H42N2O6S7 and a molecular weight of 667.07 g/mol. Its IUPAC name is 3-[[3-[[2-carboxy-2-[(2-methyl-2-sulfanylpropanoyl)amino]ethyl]disulfanyl]-8-sulfanylnonyl]disulfanyl]-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid.
| Compound Name | 3-[[3-[[2-carboxy-2-[(2-methyl-2-sulfanylpropanoyl)amino]ethyl]disulfanyl]-8-sulfanylnonyl]disulfanyl]-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167189726 |
| Molecular Formula | C23H42N2O6S7 |
| Molecular Weight | 667.07 g/mol |
| Exact Mass | 666.11 |
| IUPAC Name | 3-[[3-[[2-carboxy-2-[(2-methyl-2-sulfanylpropanoyl)amino]ethyl]disulfanyl]-8-sulfanylnonyl]disulfanyl]-2-[(2-methyl-2-sulfanylpropanoyl)amino]propanoic acid |
| SMILES | CC(S)CCCCC(CCSSCC(NC(=O)C(C)(C)S)C(=O)O)SSCC(NC(=O)C(C)(C)S)C(=O)O |
| InChI | InChI=1S/C23H42N2O6S7/c1-14(32)8-6-7-9-15(38-37-13-17(19(28)29)25-21(31)23(4,5)34)10-11-35-36-12-16(18(26)27)24-20(30)22(2,3)33/h14-17,32-34H,6-13H2,1-5H3,(H,24,30)(H,25,31)(H,26,27)(H,28,29) |
| InChIKey | LRPLELYEQUNNQA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|