C23H40N2O8S4 — CID 170447297
2-acetamido-3-[[3-[(2-acetamido-2-carboxyethyl)disulfanyl]-8-(3-methylbutan-2-yloxy)-8-oxooctyl]disulfanyl]propanoic acid (PubChem CID 170447297) has the molecular formula C23H40N2O8S4 and a molecular weight of 600.85 g/mol. Its IUPAC name is 2-acetamido-3-[[3-[(2-acetamido-2-carboxyethyl)disulfanyl]-8-(3-methylbutan-2-yloxy)-8-oxooctyl]disulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[3-[(2-acetamido-2-carboxyethyl)disulfanyl]-8-(3-methylbutan-2-yloxy)-8-oxooctyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 170447297 |
| Molecular Formula | C23H40N2O8S4 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 2-acetamido-3-[[3-[(2-acetamido-2-carboxyethyl)disulfanyl]-8-(3-methylbutan-2-yloxy)-8-oxooctyl]disulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSSCCC(CCCCC(=O)OC(C)C(C)C)SSCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H40N2O8S4/c1-14(2)15(3)33-21(28)9-7-6-8-18(37-36-13-20(23(31)32)25-17(5)27)10-11-34-35-12-19(22(29)30)24-16(4)26/h14-15,18-20H,6-13H2,1-5H3,(H,24,26)(H,25,27)(H,29,30)(H,31,32) |
| InChIKey | YOGJOIUZQIIXAO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|