C19H34N2O6S4 — CID 165173021
2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-methyloctyl]disulfanyl]propanoic acid (PubChem CID 165173021) has the molecular formula C19H34N2O6S4 and a molecular weight of 514.76 g/mol. Its IUPAC name is 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-methyloctyl]disulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-methyloctyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 165173021 |
| Molecular Formula | C19H34N2O6S4 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-methyloctyl]disulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSSCC(CCCCC(C)C)SSCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H34N2O6S4/c1-12(2)7-5-6-8-15(31-30-11-17(19(26)27)21-14(4)23)9-28-29-10-16(18(24)25)20-13(3)22/h12,15-17H,5-11H2,1-4H3,(H,20,22)(H,21,23)(H,24,25)(H,26,27) |
| InChIKey | LTQMWVXYQQOGIE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|