C25H49NO3S — CID 89028198
(2R)-2-acetamido-3-(3,7,11,15-tetramethylhexadecylsulfanyl)propanoic acid (PubChem CID 89028198) has the molecular formula C25H49NO3S and a molecular weight of 443.74 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(3,7,11,15-tetramethylhexadecylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(3,7,11,15-tetramethylhexadecylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 89028198 |
| Molecular Formula | C25H49NO3S |
| Molecular Weight | 443.74 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | (2R)-2-acetamido-3-(3,7,11,15-tetramethylhexadecylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCC(C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C25H49NO3S/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-17-30-18-24(25(28)29)26-23(6)27/h19-22,24H,7-18H2,1-6H3,(H,26,27)(H,28,29)/t20?,21?,22?,24-/m0/s1 |
| InChIKey | VTGZUHWPERPKSM-QLEIAVNASA-N |
| XLogP | 6.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|