C12H23NO5S — CID 81093475
2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid (PubChem CID 81093475) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 81093475 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
| SMILES | CCOC(CCSCC(NC(C)=O)C(=O)O)OCC |
| InChI | InChI=1S/C12H23NO5S/c1-4-17-11(18-5-2)6-7-19-8-10(12(15)16)13-9(3)14/h10-11H,4-8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | AUSGUOZQGGIYBK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|