About 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid
2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid (PubChem CID 81093475) has the molecular formula C12H23NO5S
and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid.
Molecular Properties
| Compound Name | 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
| PubChem CID | 81093475 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
| SMILES | CCOC(CCSCC(NC(C)=O)C(=O)O)OCC |
| InChI | InChI=1S/C12H23NO5S/c1-4-17-11(18-5-2)6-7-19-8-10(12(15)16)13-9(3)14/h10-11H,4-8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | AUSGUOZQGGIYBK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid?
The IUPAC name of 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid (CID 81093475) is 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid?
The canonical SMILES for 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid is CCOC(CCSCC(NC(C)=O)C(=O)O)OCC.
What is the InChIKey of 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid?
The InChIKey is AUSGUOZQGGIYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO5S/c1-4-17-11(18-5-2)6-7-19-8-10(12(15)16)13-9(3)14/h10-11H,4-8H2,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid?
2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid has a molecular weight of 293.38 g/mol, XLogP of 1.10, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(3,3-diethoxypropylsulfanyl)propanoic acid is sourced from PubChem (CID 81093475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).