C10H21NO4S — CID 54372830
(2R)-2-amino-3-(3,3-diethoxypropylsulfanyl)propanoic acid (PubChem CID 54372830) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,3-diethoxypropylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 54372830 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2R)-2-amino-3-(3,3-diethoxypropylsulfanyl)propanoic acid |
| SMILES | CCOC(CCSC[C@H](N)C(=O)O)OCC |
| InChI | InChI=1S/C10H21NO4S/c1-3-14-9(15-4-2)5-6-16-7-8(11)10(12)13/h8-9H,3-7,11H2,1-2H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | UUKNNPKNIVYSED-QMMMGPOBSA-N |
| XLogP | 0.92 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|