C7H15NO3S — CID 65369194
2-amino-4-(ethoxymethylsulfanyl)butanoic acid (PubChem CID 65369194) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-amino-4-(ethoxymethylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(ethoxymethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 65369194 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 2-amino-4-(ethoxymethylsulfanyl)butanoic acid |
| SMILES | CCOCSCCC(N)C(=O)O |
| InChI | InChI=1S/C7H15NO3S/c1-2-11-5-12-4-3-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10) |
| InChIKey | DXXKLJBVWVGECX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|