C8H13NO6S — CID 87535505
2-[[(3S)-3-amino-3-carboxypropyl]sulfanylmethyl]propanedioic acid (PubChem CID 87535505) has the molecular formula C8H13NO6S and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-[[(3S)-3-amino-3-carboxypropyl]sulfanylmethyl]propanedioic acid.
| Compound Name | 2-[[(3S)-3-amino-3-carboxypropyl]sulfanylmethyl]propanedioic acid |
|---|---|
| PubChem CID | 87535505 |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[[(3S)-3-amino-3-carboxypropyl]sulfanylmethyl]propanedioic acid |
| SMILES | N[C@@H](CCSCC(C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO6S/c9-5(8(14)15)1-2-16-3-4(6(10)11)7(12)13/h4-5H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | RIDNIRJTEZZFIH-YFKPBYRVSA-N |
| XLogP | -0.69 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|