C8H16N2O6S — CID 6852195
(2S)-2-amino-4-[(2S,3R)-2,3-dihydroxy-4-(hydroxyamino)-4-oxobutyl]sulfanylbutanoic acid (PubChem CID 6852195) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is (2S)-2-amino-4-[(2S,3R)-2,3-dihydroxy-4-(hydroxyamino)-4-oxobutyl]sulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-4-[(2S,3R)-2,3-dihydroxy-4-(hydroxyamino)-4-oxobutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 6852195 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2S)-2-amino-4-[(2S,3R)-2,3-dihydroxy-4-(hydroxyamino)-4-oxobutyl]sulfanylbutanoic acid |
| SMILES | N[C@@H](CCSC[C@@H](O)[C@@H](O)C(=O)NO)C(=O)O |
| InChI | InChI=1S/C8H16N2O6S/c9-4(8(14)15)1-2-17-3-5(11)6(12)7(13)10-16/h4-6,11-12,16H,1-3,9H2,(H,10,13)(H,14,15)/t4-,5+,6+/m0/s1 |
| InChIKey | PWFBZASPUNGGAM-KVQBGUIXSA-N |
| XLogP | -2.25 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|