C8H14N2O5S — CID 60930239
2-amino-4-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 60930239) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-amino-4-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60930239 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-amino-4-[2-(methoxycarbonylamino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | COC(=O)NC(=O)CSCCC(N)C(=O)O |
| InChI | InChI=1S/C8H14N2O5S/c1-15-8(14)10-6(11)4-16-3-2-5(9)7(12)13/h5H,2-4,9H2,1H3,(H,12,13)(H,10,11,14) |
| InChIKey | ZWNCWKZATIIKFS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|