C12H21N3O4S — CID 60930347
2-amino-4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 60930347) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-amino-4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60930347 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-amino-4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCC(=O)NC(=O)NC1CCCC1)C(=O)O |
| InChI | InChI=1S/C12H21N3O4S/c13-9(11(17)18)5-6-20-7-10(16)15-12(19)14-8-3-1-2-4-8/h8-9H,1-7,13H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | QRYQSUZWGHLMBY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|