C13H23N3O4S — CID 106442698
(2R)-2-amino-3-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (PubChem CID 106442698) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106442698 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2R)-2-amino-3-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)(SCC(=O)NC(=O)NC1CCCC1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H23N3O4S/c1-13(2,10(14)11(18)19)21-7-9(17)16-12(20)15-8-5-3-4-6-8/h8,10H,3-7,14H2,1-2H3,(H,18,19)(H2,15,16,17,20)/t10-/m1/s1 |
| InChIKey | ZRPWFRJYVRLWGI-SNVBAGLBSA-N |
| XLogP | 0.68 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |