C9H15N3O4S — CID 43385362
2-amino-3-[2-(cyclopropylcarbamoylamino)-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43385362) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-amino-3-[2-(cyclopropylcarbamoylamino)-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[2-(cyclopropylcarbamoylamino)-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43385362 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-3-[2-(cyclopropylcarbamoylamino)-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | NC(CSCC(=O)NC(=O)NC1CC1)C(=O)O |
| InChI | InChI=1S/C9H15N3O4S/c10-6(8(14)15)3-17-4-7(13)12-9(16)11-5-1-2-5/h5-6H,1-4,10H2,(H,14,15)(H2,11,12,13,16) |
| InChIKey | HJLKRZJPAWUFRJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |