C12H15N3O2S — CID 43249110
2-(2-aminophenyl)sulfanyl-N-(cyclopropylcarbamoyl)acetamide (PubChem CID 43249110) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-N-(cyclopropylcarbamoyl)acetamide.
| Compound Name | 2-(2-aminophenyl)sulfanyl-N-(cyclopropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 43249110 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-N-(cyclopropylcarbamoyl)acetamide |
| SMILES | Nc1ccccc1SCC(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C12H15N3O2S/c13-9-3-1-2-4-10(9)18-7-11(16)15-12(17)14-8-5-6-8/h1-4,8H,5-7,13H2,(H2,14,15,16,17) |
| InChIKey | IHBVNARRHXHLRP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|