C11H14N4O2S — CID 43301222
2-[(5-amino-2-pyridinyl)sulfanyl]-N-(cyclopropylcarbamoyl)acetamide (PubChem CID 43301222) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(cyclopropylcarbamoyl)acetamide.
| Compound Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(cyclopropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 43301222 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(cyclopropylcarbamoyl)acetamide |
| SMILES | Nc1ccc(SCC(=O)NC(=O)NC2CC2)nc1 |
| InChI | InChI=1S/C11H14N4O2S/c12-7-1-4-10(13-5-7)18-6-9(16)15-11(17)14-8-2-3-8/h1,4-5,8H,2-3,6,12H2,(H2,14,15,16,17) |
| InChIKey | ULRKYUNSVMESSI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |