C13H16N4OS — CID 43301359
2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyano-1-cyclopropylethyl)acetamide (PubChem CID 43301359) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyano-1-cyclopropylethyl)acetamide.
| Compound Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyano-1-cyclopropylethyl)acetamide |
|---|---|
| PubChem CID | 43301359 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[(5-amino-2-pyridinyl)sulfanyl]-N-(1-cyano-1-cyclopropylethyl)acetamide |
| SMILES | CC(C#N)(NC(=O)CSc1ccc(N)cn1)C1CC1 |
| InChI | InChI=1S/C13H16N4OS/c1-13(8-14,9-2-3-9)17-11(18)7-19-12-5-4-10(15)6-16-12/h4-6,9H,2-3,7,15H2,1H3,(H,17,18) |
| InChIKey | ZGUGHTAISDSZNG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |