C18H26N4O4S2 — CID 30117534
N-(cyclopentylcarbamoyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 30117534) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 30117534 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(S(=O)(=O)N2CCCCC2)cn1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H26N4O4S2/c23-16(21-18(24)20-14-6-2-3-7-14)13-27-17-9-8-15(12-19-17)28(25,26)22-10-4-1-5-11-22/h8-9,12,14H,1-7,10-11,13H2,(H2,20,21,23,24) |
| InChIKey | PSPHOJVCZYZHHA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |