C19H30N4O3S2 — CID 7593969
N-cycloheptyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]acetamide (PubChem CID 7593969) has the molecular formula C19H30N4O3S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-cycloheptyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-cycloheptyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7593969 |
| Molecular Formula | C19H30N4O3S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-cycloheptyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(SCC(=O)NC3CCCCCC3)nc2)CC1 |
| InChI | InChI=1S/C19H30N4O3S2/c1-22-10-12-23(13-11-22)28(25,26)17-8-9-19(20-14-17)27-15-18(24)21-16-6-4-2-3-5-7-16/h8-9,14,16H,2-7,10-13,15H2,1H3,(H,21,24) |
| InChIKey | DBOAACGBJKCJFQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |