C20H31N3O3S2 — CID 46625230
N-cycloheptyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 46625230) has the molecular formula C20H31N3O3S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-cycloheptyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | N-cycloheptyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46625230 |
| Molecular Formula | C20H31N3O3S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-cycloheptyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | CC(Sc1ccc(S(=O)(=O)N2CCCCC2)cn1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H31N3O3S2/c1-16(20(24)22-17-9-5-2-3-6-10-17)27-19-12-11-18(15-21-19)28(25,26)23-13-7-4-8-14-23/h11-12,15-17H,2-10,13-14H2,1H3,(H,22,24) |
| InChIKey | WPGQREPADDKVGK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |