C20H24FN3O3S2 — CID 46630280
N-[(4-fluorophenyl)methyl]-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 46630280) has the molecular formula C20H24FN3O3S2 and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46630280 |
| Molecular Formula | C20H24FN3O3S2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | CC(Sc1ccc(S(=O)(=O)N2CCCCC2)cn1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN3O3S2/c1-15(20(25)23-13-16-5-7-17(21)8-6-16)28-19-10-9-18(14-22-19)29(26,27)24-11-3-2-4-12-24/h5-10,14-15H,2-4,11-13H2,1H3,(H,23,25) |
| InChIKey | GPBMWMCEWNPCTG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |