C18H27N3O3S2 — CID 7561730
(2R)-N-cyclopentyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 7561730) has the molecular formula C18H27N3O3S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7561730 |
| Molecular Formula | C18H27N3O3S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(S(=O)(=O)N2CCCCC2)cn1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H27N3O3S2/c1-14(18(22)20-15-7-3-4-8-15)25-17-10-9-16(13-19-17)26(23,24)21-11-5-2-6-12-21/h9-10,13-15H,2-8,11-12H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | XSKVSVACSGSGNP-CQSZACIVSA-N |
| XLogP | 2.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |