C17H24N2O3S — CID 94813876
N-(cyclohexylcarbamoyl)-2-[(2S)-2-hydroxy-2-phenylethyl]sulfanylacetamide (PubChem CID 94813876) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[(2S)-2-hydroxy-2-phenylethyl]sulfanylacetamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[(2S)-2-hydroxy-2-phenylethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 94813876 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[(2S)-2-hydroxy-2-phenylethyl]sulfanylacetamide |
| SMILES | O=C(CSC[C@@H](O)c1ccccc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3S/c20-15(13-7-3-1-4-8-13)11-23-12-16(21)19-17(22)18-14-9-5-2-6-10-14/h1,3-4,7-8,14-15,20H,2,5-6,9-12H2,(H2,18,19,21,22)/t15-/m1/s1 |
| InChIKey | QXHOMAHSDITJAL-OAHLLOKOSA-N |
| XLogP | 2.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |