C9H17N5O2S — CID 77060858
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77060858) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060858 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C9H17N5O2S/c10-8(14-11)17-5-7(15)13-9(16)12-6-3-1-2-4-6/h6H,1-5,11H2,(H2,10,14)(H2,12,13,15,16) |
| InChIKey | AGQJNLKKEVBOTN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|