C9H16N2O3 — CID 16769602
N-(cyclohexylcarbamoyl)-2-hydroxyacetamide (PubChem CID 16769602) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-hydroxyacetamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 16769602 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-hydroxyacetamide |
| SMILES | O=C(CO)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C9H16N2O3/c12-6-8(13)11-9(14)10-7-4-2-1-3-5-7/h7,12H,1-6H2,(H2,10,11,13,14) |
| InChIKey | NUTXSENPHXTHCC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |