C17H32N3O2+ — CID 9265087
[2-(cyclohexylcarbamoylamino)-2-oxoethyl]-cyclooctylazanium (PubChem CID 9265087) has the molecular formula C17H32N3O2+ and a molecular weight of 310.46 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-cyclooctylazanium.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9265087 |
| Molecular Formula | C17H32N3O2+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl]-cyclooctylazanium |
| SMILES | O=C(C[NH2+]C1CCCCCCC1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H31N3O2/c21-16(13-18-14-9-5-2-1-3-6-10-14)20-17(22)19-15-11-7-4-8-12-15/h14-15,18H,1-13H2,(H2,19,20,21,22)/p+1 |
| InChIKey | ORXRAPPUDFDPKX-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |