C13H26N3O2+ — CID 9265109
cyclooctyl-[2-(ethylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 9265109) has the molecular formula C13H26N3O2+ and a molecular weight of 256.37 g/mol. Its IUPAC name is cyclooctyl-[2-(ethylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | cyclooctyl-[2-(ethylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9265109 |
| Molecular Formula | C13H26N3O2+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | cyclooctyl-[2-(ethylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CCNC(=O)NC(=O)C[NH2+]C1CCCCCCC1 |
| InChI | InChI=1S/C13H25N3O2/c1-2-14-13(18)16-12(17)10-15-11-8-6-4-3-5-7-9-11/h11,15H,2-10H2,1H3,(H2,14,16,17,18)/p+1 |
| InChIKey | CPKJUAILPWOPLR-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |