C7H14N4O3 — CID 134915369
1,3-bis(ethylcarbamoyl)urea (PubChem CID 134915369) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,3-bis(ethylcarbamoyl)urea.
| Compound Name | 1,3-bis(ethylcarbamoyl)urea |
|---|---|
| PubChem CID | 134915369 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1,3-bis(ethylcarbamoyl)urea |
| SMILES | CCNC(=O)NC(=O)NC(=O)NCC |
| InChI | InChI=1S/C7H14N4O3/c1-3-8-5(12)10-7(14)11-6(13)9-4-2/h3-4H2,1-2H3,(H4,8,9,10,11,12,13,14) |
| InChIKey | KACQDJPPIPGFOB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |