C6H13N3O2 — CID 130743896
N-(ethylcarbamoyl)-2-(methylamino)acetamide (PubChem CID 130743896) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(methylamino)acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 130743896 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(methylamino)acetamide |
| SMILES | CCNC(=O)NC(=O)CNC |
| InChI | InChI=1S/C6H13N3O2/c1-3-8-6(11)9-5(10)4-7-2/h7H,3-4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | SCTKOAWDOPOTAQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |