C7H18N2O — CID 142885504
1,3-diethylurea;ethane (PubChem CID 142885504) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 1,3-diethylurea;ethane.
| Compound Name | 1,3-diethylurea;ethane |
|---|---|
| PubChem CID | 142885504 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 1,3-diethylurea;ethane |
| SMILES | CC.CCNC(=O)NCC |
| InChI | InChI=1S/C5H12N2O.C2H6/c1-3-6-5(8)7-4-2;1-2/h3-4H2,1-2H3,(H2,6,7,8);1-2H3 |
| InChIKey | DXPVVIGUOVUQJP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |